C11H17Cl2N5O — CID 119856894
4-(methylamino)-N-([1,2,4]triazolo[4,3-a]pyridin-3-yl)butanamide;dihydrochloride (PubChem CID 119856894) has the molecular formula C11H17Cl2N5O and a molecular weight of 306.20 g/mol. Its IUPAC name is 4-(methylamino)-N-([1,2,4]triazolo[4,3-a]pyridin-3-yl)butanamide;dihydrochloride.
| Compound Name | 4-(methylamino)-N-([1,2,4]triazolo[4,3-a]pyridin-3-yl)butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119856894 |
| Molecular Formula | C11H17Cl2N5O |
| Molecular Weight | 306.20 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 4-(methylamino)-N-([1,2,4]triazolo[4,3-a]pyridin-3-yl)butanamide;dihydrochloride |
| SMILES | CNCCCC(=O)Nc1nnc2ccccn12.Cl.Cl |
| InChI | InChI=1S/C11H15N5O.2ClH/c1-12-7-4-6-10(17)13-11-15-14-9-5-2-3-8-16(9)11;;/h2-3,5,8,12H,4,6-7H2,1H3,(H,13,15,17);2*1H |
| InChIKey | IHPQJUAFBGZQSU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.20 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|