C21H24N6O3 — CID 53204329
4-[4-(4-methoxyphenyl)piperazin-1-yl]-4-oxo-N-([1,2,4]triazolo[4,3-a]pyridin-3-yl)butanamide (PubChem CID 53204329) has the molecular formula C21H24N6O3 and a molecular weight of 408.46 g/mol. Its IUPAC name is 4-[4-(4-methoxyphenyl)piperazin-1-yl]-4-oxo-N-([1,2,4]triazolo[4,3-a]pyridin-3-yl)butanamide.
| Compound Name | 4-[4-(4-methoxyphenyl)piperazin-1-yl]-4-oxo-N-([1,2,4]triazolo[4,3-a]pyridin-3-yl)butanamide |
|---|---|
| PubChem CID | 53204329 |
| Molecular Formula | C21H24N6O3 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 4-[4-(4-methoxyphenyl)piperazin-1-yl]-4-oxo-N-([1,2,4]triazolo[4,3-a]pyridin-3-yl)butanamide |
| SMILES | COc1ccc(N2CCN(C(=O)CCC(=O)Nc3nnc4ccccn34)CC2)cc1 |
| InChI | InChI=1S/C21H24N6O3/c1-30-17-7-5-16(6-8-17)25-12-14-26(15-13-25)20(29)10-9-19(28)22-21-24-23-18-4-2-3-11-27(18)21/h2-8,11H,9-10,12-15H2,1H3,(H,22,24,28) |
| InChIKey | BSGNLECGOFLFOM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|