C10H10N4O3 — CID 110471107
ethyl 2-oxo-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylamino)acetate (PubChem CID 110471107) has the molecular formula C10H10N4O3 and a molecular weight of 234.22 g/mol. Its IUPAC name is ethyl 2-oxo-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylamino)acetate.
| Compound Name | ethyl 2-oxo-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylamino)acetate |
|---|---|
| PubChem CID | 110471107 |
| Molecular Formula | C10H10N4O3 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | ethyl 2-oxo-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylamino)acetate |
| SMILES | CCOC(=O)C(=O)Nc1nnc2ccccn12 |
| InChI | InChI=1S/C10H10N4O3/c1-2-17-9(16)8(15)11-10-13-12-7-5-3-4-6-14(7)10/h3-6H,2H2,1H3,(H,11,13,15) |
| InChIKey | VHDBBKBFMPWNBM-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|