C16H18N6O2S — CID 75443566
N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N'-([1,2,4]triazolo[4,3-a]pyridin-3-yl)oxamide (PubChem CID 75443566) has the molecular formula C16H18N6O2S and a molecular weight of 358.43 g/mol. Its IUPAC name is N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N'-([1,2,4]triazolo[4,3-a]pyridin-3-yl)oxamide.
| Compound Name | N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N'-([1,2,4]triazolo[4,3-a]pyridin-3-yl)oxamide |
|---|---|
| PubChem CID | 75443566 |
| Molecular Formula | C16H18N6O2S |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | N-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-N'-([1,2,4]triazolo[4,3-a]pyridin-3-yl)oxamide |
| SMILES | CC(C)(C)c1nc(CNC(=O)C(=O)Nc2nnc3ccccn23)cs1 |
| InChI | InChI=1S/C16H18N6O2S/c1-16(2,3)14-18-10(9-25-14)8-17-12(23)13(24)19-15-21-20-11-6-4-5-7-22(11)15/h4-7,9H,8H2,1-3H3,(H,17,23)(H,19,21,24) |
| InChIKey | VMRAQYHKMMBHDC-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 101.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|