C17H19FN2O2 — CID 71856330
N-[cyclopentyl-(2-fluorophenyl)methyl]-2-(1,2-oxazol-3-yl)acetamide (PubChem CID 71856330) has the molecular formula C17H19FN2O2 and a molecular weight of 302.35 g/mol. Its IUPAC name is N-[cyclopentyl-(2-fluorophenyl)methyl]-2-(1,2-oxazol-3-yl)acetamide.
| Compound Name | N-[cyclopentyl-(2-fluorophenyl)methyl]-2-(1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 71856330 |
| Molecular Formula | C17H19FN2O2 |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | N-[cyclopentyl-(2-fluorophenyl)methyl]-2-(1,2-oxazol-3-yl)acetamide |
| SMILES | O=C(Cc1ccon1)NC(c1ccccc1F)C1CCCC1 |
| InChI | InChI=1S/C17H19FN2O2/c18-15-8-4-3-7-14(15)17(12-5-1-2-6-12)19-16(21)11-13-9-10-22-20-13/h3-4,7-10,12,17H,1-2,5-6,11H2,(H,19,21) |
| InChIKey | XJJVWNQVJNOVCX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |