C24H23NO4 — CID 7185731
[4-(phenylcarbamoyl)phenyl]methyl 4-phenoxybutanoate (PubChem CID 7185731) has the molecular formula C24H23NO4 and a molecular weight of 389.45 g/mol. Its IUPAC name is [4-(phenylcarbamoyl)phenyl]methyl 4-phenoxybutanoate.
| Compound Name | [4-(phenylcarbamoyl)phenyl]methyl 4-phenoxybutanoate |
|---|---|
| PubChem CID | 7185731 |
| Molecular Formula | C24H23NO4 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | [4-(phenylcarbamoyl)phenyl]methyl 4-phenoxybutanoate |
| SMILES | O=C(CCCOc1ccccc1)OCc1ccc(C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C24H23NO4/c26-23(12-7-17-28-22-10-5-2-6-11-22)29-18-19-13-15-20(16-14-19)24(27)25-21-8-3-1-4-9-21/h1-6,8-11,13-16H,7,12,17-18H2,(H,25,27) |
| InChIKey | UMRPLHCXJXRZHU-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|