About 2-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1-benzothiophene-3-sulfonamide
2-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1-benzothiophene-3-sulfonamide (PubChem CID 71858382) has the molecular formula C12H11N3O2S3
and a molecular weight of 325.44 g/mol. Its IUPAC name is 2-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1-benzothiophene-3-sulfonamide.
Molecular Properties
| Compound Name | 2-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1-benzothiophene-3-sulfonamide |
| PubChem CID | 71858382 |
| Molecular Formula | C12H11N3O2S3 |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.00 |
| IUPAC Name | 2-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1-benzothiophene-3-sulfonamide |
| SMILES | Cc1nnc(NS(=O)(=O)c2c(C)sc3ccccc23)s1 |
| InChI | InChI=1S/C12H11N3O2S3/c1-7-11(9-5-3-4-6-10(9)18-7)20(16,17)15-12-14-13-8(2)19-12/h3-6H,1-2H3,(H,14,15) |
| InChIKey | CLZCXUAZUQKRQY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1-benzothiophene-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1-benzothiophene-3-sulfonamide?
The IUPAC name of 2-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1-benzothiophene-3-sulfonamide (CID 71858382) is 2-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1-benzothiophene-3-sulfonamide.
What is the SMILES notation for 2-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1-benzothiophene-3-sulfonamide?
The canonical SMILES for 2-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1-benzothiophene-3-sulfonamide is Cc1nnc(NS(=O)(=O)c2c(C)sc3ccccc23)s1.
What is the InChIKey of 2-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1-benzothiophene-3-sulfonamide?
The InChIKey is CLZCXUAZUQKRQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O2S3/c1-7-11(9-5-3-4-6-10(9)18-7)20(16,17)15-12-14-13-8(2)19-12/h3-6H,1-2H3,(H,14,15).
What are the key properties of 2-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1-benzothiophene-3-sulfonamide?
2-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1-benzothiophene-3-sulfonamide has a molecular weight of 325.44 g/mol, XLogP of 3.17, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)-1-benzothiophene-3-sulfonamide is sourced from PubChem (CID 71858382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).