C15H15ClN2O4 — CID 71858940
methyl 3-[(7-chloro-1-benzofuran-2-carbonyl)amino]pyrrolidine-1-carboxylate (PubChem CID 71858940) has the molecular formula C15H15ClN2O4 and a molecular weight of 322.75 g/mol. Its IUPAC name is methyl 3-[(7-chloro-1-benzofuran-2-carbonyl)amino]pyrrolidine-1-carboxylate.
| Compound Name | methyl 3-[(7-chloro-1-benzofuran-2-carbonyl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 71858940 |
| Molecular Formula | C15H15ClN2O4 |
| Molecular Weight | 322.75 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | methyl 3-[(7-chloro-1-benzofuran-2-carbonyl)amino]pyrrolidine-1-carboxylate |
| SMILES | COC(=O)N1CCC(NC(=O)c2cc3cccc(Cl)c3o2)C1 |
| InChI | InChI=1S/C15H15ClN2O4/c1-21-15(20)18-6-5-10(8-18)17-14(19)12-7-9-3-2-4-11(16)13(9)22-12/h2-4,7,10H,5-6,8H2,1H3,(H,17,19) |
| InChIKey | HSOIIYYACXSUKF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.75 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |