C17H24N2O4 — CID 71860491
1-(1,3-benzodioxol-5-ylmethyl)-3-[1-(2-hydroxyethyl)cyclohexyl]urea (PubChem CID 71860491) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[1-(2-hydroxyethyl)cyclohexyl]urea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[1-(2-hydroxyethyl)cyclohexyl]urea |
|---|---|
| PubChem CID | 71860491 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[1-(2-hydroxyethyl)cyclohexyl]urea |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)NC1(CCO)CCCCC1 |
| InChI | InChI=1S/C17H24N2O4/c20-9-8-17(6-2-1-3-7-17)19-16(21)18-11-13-4-5-14-15(10-13)23-12-22-14/h4-5,10,20H,1-3,6-9,11-12H2,(H2,18,19,21) |
| InChIKey | POCADRZAJDJRSD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |