C18H21N3O2S — CID 71861057
4-(5-methylthiophen-2-yl)-N-[3-(2-oxoimidazolidin-1-yl)phenyl]butanamide (PubChem CID 71861057) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is 4-(5-methylthiophen-2-yl)-N-[3-(2-oxoimidazolidin-1-yl)phenyl]butanamide.
| Compound Name | 4-(5-methylthiophen-2-yl)-N-[3-(2-oxoimidazolidin-1-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 71861057 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 4-(5-methylthiophen-2-yl)-N-[3-(2-oxoimidazolidin-1-yl)phenyl]butanamide |
| SMILES | Cc1ccc(CCCC(=O)Nc2cccc(N3CCNC3=O)c2)s1 |
| InChI | InChI=1S/C18H21N3O2S/c1-13-8-9-16(24-13)6-3-7-17(22)20-14-4-2-5-15(12-14)21-11-10-19-18(21)23/h2,4-5,8-9,12H,3,6-7,10-11H2,1H3,(H,19,23)(H,20,22) |
| InChIKey | NFEMWLVSJMBWKM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |