C16H17N3O2S — CID 47072523
2-(5-methylthiophen-2-yl)-N-[4-(2-oxoimidazolidin-1-yl)phenyl]acetamide (PubChem CID 47072523) has the molecular formula C16H17N3O2S and a molecular weight of 315.40 g/mol. Its IUPAC name is 2-(5-methylthiophen-2-yl)-N-[4-(2-oxoimidazolidin-1-yl)phenyl]acetamide.
| Compound Name | 2-(5-methylthiophen-2-yl)-N-[4-(2-oxoimidazolidin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 47072523 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 2-(5-methylthiophen-2-yl)-N-[4-(2-oxoimidazolidin-1-yl)phenyl]acetamide |
| SMILES | Cc1ccc(CC(=O)Nc2ccc(N3CCNC3=O)cc2)s1 |
| InChI | InChI=1S/C16H17N3O2S/c1-11-2-7-14(22-11)10-15(20)18-12-3-5-13(6-4-12)19-9-8-17-16(19)21/h2-7H,8-10H2,1H3,(H,17,21)(H,18,20) |
| InChIKey | XZJZJFJBBYUZHW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |