About 3-(2-methyl-1,3-thiazol-4-yl)-N-[4-(2-oxoimidazolidin-1-yl)phenyl]propanamide
3-(2-methyl-1,3-thiazol-4-yl)-N-[4-(2-oxoimidazolidin-1-yl)phenyl]propanamide (PubChem CID 167803382) has the molecular formula C16H18N4O2S
and a molecular weight of 330.41 g/mol. Its IUPAC name is 3-(2-methyl-1,3-thiazol-4-yl)-N-[4-(2-oxoimidazolidin-1-yl)phenyl]propanamide.
Molecular Properties
| Compound Name | 3-(2-methyl-1,3-thiazol-4-yl)-N-[4-(2-oxoimidazolidin-1-yl)phenyl]propanamide |
| PubChem CID | 167803382 |
| Molecular Formula | C16H18N4O2S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 3-(2-methyl-1,3-thiazol-4-yl)-N-[4-(2-oxoimidazolidin-1-yl)phenyl]propanamide |
| SMILES | Cc1nc(CCC(=O)Nc2ccc(N3CCNC3=O)cc2)cs1 |
| InChI | InChI=1S/C16H18N4O2S/c1-11-18-13(10-23-11)4-7-15(21)19-12-2-5-14(6-3-12)20-9-8-17-16(20)22/h2-3,5-6,10H,4,7-9H2,1H3,(H,17,22)(H,19,21) |
| InChIKey | FHENKXBFNYKNFE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(2-methyl-1,3-thiazol-4-yl)-N-[4-(2-oxoimidazolidin-1-yl)phenyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methyl-1,3-thiazol-4-yl)-N-[4-(2-oxoimidazolidin-1-yl)phenyl]propanamide?
The IUPAC name of 3-(2-methyl-1,3-thiazol-4-yl)-N-[4-(2-oxoimidazolidin-1-yl)phenyl]propanamide (CID 167803382) is 3-(2-methyl-1,3-thiazol-4-yl)-N-[4-(2-oxoimidazolidin-1-yl)phenyl]propanamide.
What is the SMILES notation for 3-(2-methyl-1,3-thiazol-4-yl)-N-[4-(2-oxoimidazolidin-1-yl)phenyl]propanamide?
The canonical SMILES for 3-(2-methyl-1,3-thiazol-4-yl)-N-[4-(2-oxoimidazolidin-1-yl)phenyl]propanamide is Cc1nc(CCC(=O)Nc2ccc(N3CCNC3=O)cc2)cs1.
What is the InChIKey of 3-(2-methyl-1,3-thiazol-4-yl)-N-[4-(2-oxoimidazolidin-1-yl)phenyl]propanamide?
The InChIKey is FHENKXBFNYKNFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N4O2S/c1-11-18-13(10-23-11)4-7-15(21)19-12-2-5-14(6-3-12)20-9-8-17-16(20)22/h2-3,5-6,10H,4,7-9H2,1H3,(H,17,22)(H,19,21).
What are the key properties of 3-(2-methyl-1,3-thiazol-4-yl)-N-[4-(2-oxoimidazolidin-1-yl)phenyl]propanamide?
3-(2-methyl-1,3-thiazol-4-yl)-N-[4-(2-oxoimidazolidin-1-yl)phenyl]propanamide has a molecular weight of 330.41 g/mol, XLogP of 2.55, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methyl-1,3-thiazol-4-yl)-N-[4-(2-oxoimidazolidin-1-yl)phenyl]propanamide is sourced from PubChem (CID 167803382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).