C16H15N5O3 — CID 71862115
N-[1-(3-nitrophenyl)propyl]-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide (PubChem CID 71862115) has the molecular formula C16H15N5O3 and a molecular weight of 325.33 g/mol. Its IUPAC name is N-[1-(3-nitrophenyl)propyl]-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide.
| Compound Name | N-[1-(3-nitrophenyl)propyl]-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 71862115 |
| Molecular Formula | C16H15N5O3 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | N-[1-(3-nitrophenyl)propyl]-[1,2,4]triazolo[4,3-a]pyridine-6-carboxamide |
| SMILES | CCC(NC(=O)c1ccc2nncn2c1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H15N5O3/c1-2-14(11-4-3-5-13(8-11)21(23)24)18-16(22)12-6-7-15-19-17-10-20(15)9-12/h3-10,14H,2H2,1H3,(H,18,22) |
| InChIKey | IKJHXZCHGTVIAL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|