C16H12ClN2O5- — CID 7310727
(3S)-3-[(3-chlorobenzoyl)amino]-3-(3-nitrophenyl)propanoate (PubChem CID 7310727) has the molecular formula C16H12ClN2O5- and a molecular weight of 347.73 g/mol. Its IUPAC name is (3S)-3-[(3-chlorobenzoyl)amino]-3-(3-nitrophenyl)propanoate.
| Compound Name | (3S)-3-[(3-chlorobenzoyl)amino]-3-(3-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 7310727 |
| Molecular Formula | C16H12ClN2O5- |
| Molecular Weight | 347.73 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | (3S)-3-[(3-chlorobenzoyl)amino]-3-(3-nitrophenyl)propanoate |
| SMILES | O=C([O-])C[C@H](NC(=O)c1cccc(Cl)c1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H13ClN2O5/c17-12-5-1-4-11(7-12)16(22)18-14(9-15(20)21)10-3-2-6-13(8-10)19(23)24/h1-8,14H,9H2,(H,18,22)(H,20,21)/p-1/t14-/m0/s1 |
| InChIKey | YZGZAOHBRUIXSO-AWEZNQCLSA-M |
| XLogP | 1.86 |
| TPSA | 112.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.73 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|