C16H18N4O2S — CID 71862589
3-[1-[(3-cyano-4,6-dimethyl-2-pyridinyl)amino]ethyl]benzenesulfonamide (PubChem CID 71862589) has the molecular formula C16H18N4O2S and a molecular weight of 330.41 g/mol. Its IUPAC name is 3-[1-[(3-cyano-4,6-dimethyl-2-pyridinyl)amino]ethyl]benzenesulfonamide.
| Compound Name | 3-[1-[(3-cyano-4,6-dimethyl-2-pyridinyl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 71862589 |
| Molecular Formula | C16H18N4O2S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 3-[1-[(3-cyano-4,6-dimethyl-2-pyridinyl)amino]ethyl]benzenesulfonamide |
| SMILES | Cc1cc(C)c(C#N)c(NC(C)c2cccc(S(N)(=O)=O)c2)n1 |
| InChI | InChI=1S/C16H18N4O2S/c1-10-7-11(2)19-16(15(10)9-17)20-12(3)13-5-4-6-14(8-13)23(18,21)22/h4-8,12H,1-3H3,(H,19,20)(H2,18,21,22) |
| InChIKey | PCJYDCNBRSSDEZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |