C10H9F2N5O2 — CID 71862860
N-[1-(2,2-difluoroethyl)pyrazol-3-yl]-5-nitropyridin-2-amine (PubChem CID 71862860) has the molecular formula C10H9F2N5O2 and a molecular weight of 269.21 g/mol. Its IUPAC name is N-[1-(2,2-difluoroethyl)pyrazol-3-yl]-5-nitropyridin-2-amine.
| Compound Name | N-[1-(2,2-difluoroethyl)pyrazol-3-yl]-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 71862860 |
| Molecular Formula | C10H9F2N5O2 |
| Molecular Weight | 269.21 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | N-[1-(2,2-difluoroethyl)pyrazol-3-yl]-5-nitropyridin-2-amine |
| SMILES | O=[N+]([O-])c1ccc(Nc2ccn(CC(F)F)n2)nc1 |
| InChI | InChI=1S/C10H9F2N5O2/c11-8(12)6-16-4-3-10(15-16)14-9-2-1-7(5-13-9)17(18)19/h1-5,8H,6H2,(H,13,14,15) |
| InChIKey | YRJFBABHLPBBBF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.21 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|