About 5-nitro-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]pyridin-2-amine
5-nitro-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]pyridin-2-amine (PubChem CID 71996316) has the molecular formula C15H14N6O2
and a molecular weight of 310.32 g/mol. Its IUPAC name is 5-nitro-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]pyridin-2-amine.
Molecular Properties
| Compound Name | 5-nitro-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]pyridin-2-amine |
| PubChem CID | 71996316 |
| Molecular Formula | C15H14N6O2 |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 5-nitro-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]pyridin-2-amine |
| SMILES | O=[N+]([O-])c1ccc(NC(Cn2cncn2)c2ccccc2)nc1 |
| InChI | InChI=1S/C15H14N6O2/c22-21(23)13-6-7-15(17-8-13)19-14(9-20-11-16-10-18-20)12-4-2-1-3-5-12/h1-8,10-11,14H,9H2,(H,17,19) |
| InChIKey | PZCJHPTWQQQKEC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]pyridin-2-amine?
The IUPAC name of 5-nitro-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]pyridin-2-amine (CID 71996316) is 5-nitro-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]pyridin-2-amine.
What is the SMILES notation for 5-nitro-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]pyridin-2-amine?
The canonical SMILES for 5-nitro-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]pyridin-2-amine is O=[N+]([O-])c1ccc(NC(Cn2cncn2)c2ccccc2)nc1.
What is the InChIKey of 5-nitro-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]pyridin-2-amine?
The InChIKey is PZCJHPTWQQQKEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N6O2/c22-21(23)13-6-7-15(17-8-13)19-14(9-20-11-16-10-18-20)12-4-2-1-3-5-12/h1-8,10-11,14H,9H2,(H,17,19).
What are the key properties of 5-nitro-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]pyridin-2-amine?
5-nitro-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]pyridin-2-amine has a molecular weight of 310.32 g/mol, XLogP of 2.43, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]pyridin-2-amine is sourced from PubChem (CID 71996316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).