C15H14N6O2 — CID 71996316
5-nitro-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]pyridin-2-amine (PubChem CID 71996316) has the molecular formula C15H14N6O2 and a molecular weight of 310.32 g/mol. Its IUPAC name is 5-nitro-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]pyridin-2-amine.
| Compound Name | 5-nitro-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 71996316 |
| Molecular Formula | C15H14N6O2 |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 5-nitro-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]pyridin-2-amine |
| SMILES | O=[N+]([O-])c1ccc(NC(Cn2cncn2)c2ccccc2)nc1 |
| InChI | InChI=1S/C15H14N6O2/c22-21(23)13-6-7-15(17-8-13)19-14(9-20-11-16-10-18-20)12-4-2-1-3-5-12/h1-8,10-11,14H,9H2,(H,17,19) |
| InChIKey | PZCJHPTWQQQKEC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|