C16H16N6O2 — CID 95968499
4-methyl-5-nitro-N-[(1S)-1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]pyridin-2-amine (PubChem CID 95968499) has the molecular formula C16H16N6O2 and a molecular weight of 324.34 g/mol. Its IUPAC name is 4-methyl-5-nitro-N-[(1S)-1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]pyridin-2-amine.
| Compound Name | 4-methyl-5-nitro-N-[(1S)-1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 95968499 |
| Molecular Formula | C16H16N6O2 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 4-methyl-5-nitro-N-[(1S)-1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]pyridin-2-amine |
| SMILES | Cc1cc(N[C@H](Cn2cncn2)c2ccccc2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H16N6O2/c1-12-7-16(18-8-15(12)22(23)24)20-14(9-21-11-17-10-19-21)13-5-3-2-4-6-13/h2-8,10-11,14H,9H2,1H3,(H,18,20)/t14-/m1/s1 |
| InChIKey | FWJXOEDJXAACJG-CQSZACIVSA-N |
| XLogP | 2.74 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|