C18H28N2O2 — CID 71863517
2-(N-ethylanilino)-N-[(2-hydroxy-1-methylcyclohexyl)methyl]acetamide (PubChem CID 71863517) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is 2-(N-ethylanilino)-N-[(2-hydroxy-1-methylcyclohexyl)methyl]acetamide.
| Compound Name | 2-(N-ethylanilino)-N-[(2-hydroxy-1-methylcyclohexyl)methyl]acetamide |
|---|---|
| PubChem CID | 71863517 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 2-(N-ethylanilino)-N-[(2-hydroxy-1-methylcyclohexyl)methyl]acetamide |
| SMILES | CCN(CC(=O)NCC1(C)CCCCC1O)c1ccccc1 |
| InChI | InChI=1S/C18H28N2O2/c1-3-20(15-9-5-4-6-10-15)13-17(22)19-14-18(2)12-8-7-11-16(18)21/h4-6,9-10,16,21H,3,7-8,11-14H2,1-2H3,(H,19,22) |
| InChIKey | IZKDTPFMRFGQDE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |