C12H18ClNO2S — CID 71864025
3-(5-chlorothiophen-2-yl)-N-(3-hydroxybutyl)-N-methylpropanamide (PubChem CID 71864025) has the molecular formula C12H18ClNO2S and a molecular weight of 275.80 g/mol. Its IUPAC name is 3-(5-chlorothiophen-2-yl)-N-(3-hydroxybutyl)-N-methylpropanamide.
| Compound Name | 3-(5-chlorothiophen-2-yl)-N-(3-hydroxybutyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 71864025 |
| Molecular Formula | C12H18ClNO2S |
| Molecular Weight | 275.80 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 3-(5-chlorothiophen-2-yl)-N-(3-hydroxybutyl)-N-methylpropanamide |
| SMILES | CC(O)CCN(C)C(=O)CCc1ccc(Cl)s1 |
| InChI | InChI=1S/C12H18ClNO2S/c1-9(15)7-8-14(2)12(16)6-4-10-3-5-11(13)17-10/h3,5,9,15H,4,6-8H2,1-2H3 |
| InChIKey | NRHFFCAPAIWPQR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.80 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |