C21H21N3O4 — CID 71864234
1-[2-(2-cyanophenoxy)acetyl]-N-(4-hydroxyphenyl)piperidine-4-carboxamide (PubChem CID 71864234) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is 1-[2-(2-cyanophenoxy)acetyl]-N-(4-hydroxyphenyl)piperidine-4-carboxamide.
| Compound Name | 1-[2-(2-cyanophenoxy)acetyl]-N-(4-hydroxyphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 71864234 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 1-[2-(2-cyanophenoxy)acetyl]-N-(4-hydroxyphenyl)piperidine-4-carboxamide |
| SMILES | N#Cc1ccccc1OCC(=O)N1CCC(C(=O)Nc2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C21H21N3O4/c22-13-16-3-1-2-4-19(16)28-14-20(26)24-11-9-15(10-12-24)21(27)23-17-5-7-18(25)8-6-17/h1-8,15,25H,9-12,14H2,(H,23,27) |
| InChIKey | UFBXUPJCIPICEW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|