C19H28N4O2 — CID 71866711
4-[[2-(4-cyclopentyl-1,4-diazepan-1-yl)-2-oxoethyl]amino]benzamide (PubChem CID 71866711) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 4-[[2-(4-cyclopentyl-1,4-diazepan-1-yl)-2-oxoethyl]amino]benzamide.
| Compound Name | 4-[[2-(4-cyclopentyl-1,4-diazepan-1-yl)-2-oxoethyl]amino]benzamide |
|---|---|
| PubChem CID | 71866711 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 4-[[2-(4-cyclopentyl-1,4-diazepan-1-yl)-2-oxoethyl]amino]benzamide |
| SMILES | NC(=O)c1ccc(NCC(=O)N2CCCN(C3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C19H28N4O2/c20-19(25)15-6-8-16(9-7-15)21-14-18(24)23-11-3-10-22(12-13-23)17-4-1-2-5-17/h6-9,17,21H,1-5,10-14H2,(H2,20,25) |
| InChIKey | CHQMIUQZXJIMEQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |