C11H11F2N3O2S — CID 71867365
3-(difluoromethoxy)-N-(5-ethyl-1H-pyrazol-3-yl)thiophene-2-carboxamide (PubChem CID 71867365) has the molecular formula C11H11F2N3O2S and a molecular weight of 287.29 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N-(5-ethyl-1H-pyrazol-3-yl)thiophene-2-carboxamide.
| Compound Name | 3-(difluoromethoxy)-N-(5-ethyl-1H-pyrazol-3-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 71867365 |
| Molecular Formula | C11H11F2N3O2S |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 3-(difluoromethoxy)-N-(5-ethyl-1H-pyrazol-3-yl)thiophene-2-carboxamide |
| SMILES | CCc1cc(NC(=O)c2sccc2OC(F)F)n[nH]1 |
| InChI | InChI=1S/C11H11F2N3O2S/c1-2-6-5-8(16-15-6)14-10(17)9-7(3-4-19-9)18-11(12)13/h3-5,11H,2H2,1H3,(H2,14,15,16,17) |
| InChIKey | MFNNBFLVRPRHID-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |