C20H28N2O3 — CID 71868570
N-[1-(4-propan-2-yloxyphenyl)ethyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboxamide (PubChem CID 71868570) has the molecular formula C20H28N2O3 and a molecular weight of 344.45 g/mol. Its IUPAC name is N-[1-(4-propan-2-yloxyphenyl)ethyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboxamide.
| Compound Name | N-[1-(4-propan-2-yloxyphenyl)ethyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboxamide |
|---|---|
| PubChem CID | 71868570 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | N-[1-(4-propan-2-yloxyphenyl)ethyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboxamide |
| SMILES | CC(C)Oc1ccc(C(C)NC(=O)N2CC3C4CCC(O4)C3C2)cc1 |
| InChI | InChI=1S/C20H28N2O3/c1-12(2)24-15-6-4-14(5-7-15)13(3)21-20(23)22-10-16-17(11-22)19-9-8-18(16)25-19/h4-7,12-13,16-19H,8-11H2,1-3H3,(H,21,23) |
| InChIKey | WKQZBEHBBCZECL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |