About 2-(pyridine-4-carbonylamino)ethyl 1H-indole-7-carboxylate
2-(pyridine-4-carbonylamino)ethyl 1H-indole-7-carboxylate (PubChem CID 71869452) has the molecular formula C17H15N3O3
and a molecular weight of 309.33 g/mol. Its IUPAC name is 2-(pyridine-4-carbonylamino)ethyl 1H-indole-7-carboxylate.
Molecular Properties
| Compound Name | 2-(pyridine-4-carbonylamino)ethyl 1H-indole-7-carboxylate |
| PubChem CID | 71869452 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 2-(pyridine-4-carbonylamino)ethyl 1H-indole-7-carboxylate |
| SMILES | O=C(NCCOC(=O)c1cccc2cc[nH]c12)c1ccncc1 |
| InChI | InChI=1S/C17H15N3O3/c21-16(13-4-7-18-8-5-13)20-10-11-23-17(22)14-3-1-2-12-6-9-19-15(12)14/h1-9,19H,10-11H2,(H,20,21) |
| InChIKey | CDLDXHONJLUCDY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(pyridine-4-carbonylamino)ethyl 1H-indole-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(pyridine-4-carbonylamino)ethyl 1H-indole-7-carboxylate?
The IUPAC name of 2-(pyridine-4-carbonylamino)ethyl 1H-indole-7-carboxylate (CID 71869452) is 2-(pyridine-4-carbonylamino)ethyl 1H-indole-7-carboxylate.
What is the SMILES notation for 2-(pyridine-4-carbonylamino)ethyl 1H-indole-7-carboxylate?
The canonical SMILES for 2-(pyridine-4-carbonylamino)ethyl 1H-indole-7-carboxylate is O=C(NCCOC(=O)c1cccc2cc[nH]c12)c1ccncc1.
What is the InChIKey of 2-(pyridine-4-carbonylamino)ethyl 1H-indole-7-carboxylate?
The InChIKey is CDLDXHONJLUCDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N3O3/c21-16(13-4-7-18-8-5-13)20-10-11-23-17(22)14-3-1-2-12-6-9-19-15(12)14/h1-9,19H,10-11H2,(H,20,21).
What are the key properties of 2-(pyridine-4-carbonylamino)ethyl 1H-indole-7-carboxylate?
2-(pyridine-4-carbonylamino)ethyl 1H-indole-7-carboxylate has a molecular weight of 309.33 g/mol, XLogP of 2.15, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(pyridine-4-carbonylamino)ethyl 1H-indole-7-carboxylate is sourced from PubChem (CID 71869452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).