C16H12BrF3N2O3 — CID 75450742
2-(pyridine-4-carbonylamino)ethyl 4-bromo-2-(trifluoromethyl)benzoate (PubChem CID 75450742) has the molecular formula C16H12BrF3N2O3 and a molecular weight of 417.18 g/mol. Its IUPAC name is 2-(pyridine-4-carbonylamino)ethyl 4-bromo-2-(trifluoromethyl)benzoate.
| Compound Name | 2-(pyridine-4-carbonylamino)ethyl 4-bromo-2-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 75450742 |
| Molecular Formula | C16H12BrF3N2O3 |
| Molecular Weight | 417.18 g/mol |
| Exact Mass | 416.00 |
| IUPAC Name | 2-(pyridine-4-carbonylamino)ethyl 4-bromo-2-(trifluoromethyl)benzoate |
| SMILES | O=C(NCCOC(=O)c1ccc(Br)cc1C(F)(F)F)c1ccncc1 |
| InChI | InChI=1S/C16H12BrF3N2O3/c17-11-1-2-12(13(9-11)16(18,19)20)15(24)25-8-7-22-14(23)10-3-5-21-6-4-10/h1-6,9H,7-8H2,(H,22,23) |
| InChIKey | AQRNGRDHRBYSAJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.18 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|