C24H27N5O4 — CID 71869475
ethyl N-methyl-N-[4-[[2-[[2-(1-methylimidazol-2-yl)-1-phenylethyl]amino]-2-oxoacetyl]amino]phenyl]carbamate (PubChem CID 71869475) has the molecular formula C24H27N5O4 and a molecular weight of 449.51 g/mol. Its IUPAC name is ethyl N-methyl-N-[4-[[2-[[2-(1-methylimidazol-2-yl)-1-phenylethyl]amino]-2-oxoacetyl]amino]phenyl]carbamate.
| Compound Name | ethyl N-methyl-N-[4-[[2-[[2-(1-methylimidazol-2-yl)-1-phenylethyl]amino]-2-oxoacetyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 71869475 |
| Molecular Formula | C24H27N5O4 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | ethyl N-methyl-N-[4-[[2-[[2-(1-methylimidazol-2-yl)-1-phenylethyl]amino]-2-oxoacetyl]amino]phenyl]carbamate |
| SMILES | CCOC(=O)N(C)c1ccc(NC(=O)C(=O)NC(Cc2nccn2C)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H27N5O4/c1-4-33-24(32)29(3)19-12-10-18(11-13-19)26-22(30)23(31)27-20(17-8-6-5-7-9-17)16-21-25-14-15-28(21)2/h5-15,20H,4,16H2,1-3H3,(H,26,30)(H,27,31) |
| InChIKey | ZCNUFGNEHOQMOF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|