C24H26N4O4 — CID 97010260
N'-[(1R)-2-(1-methylimidazol-2-yl)-1-phenylethyl]-N-[4-[(3R)-oxolan-3-yl]oxyphenyl]oxamide (PubChem CID 97010260) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is N'-[(1R)-2-(1-methylimidazol-2-yl)-1-phenylethyl]-N-[4-[(3R)-oxolan-3-yl]oxyphenyl]oxamide.
| Compound Name | N'-[(1R)-2-(1-methylimidazol-2-yl)-1-phenylethyl]-N-[4-[(3R)-oxolan-3-yl]oxyphenyl]oxamide |
|---|---|
| PubChem CID | 97010260 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | N'-[(1R)-2-(1-methylimidazol-2-yl)-1-phenylethyl]-N-[4-[(3R)-oxolan-3-yl]oxyphenyl]oxamide |
| SMILES | Cn1ccnc1C[C@@H](NC(=O)C(=O)Nc1ccc(O[C@@H]2CCOC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H26N4O4/c1-28-13-12-25-22(28)15-21(17-5-3-2-4-6-17)27-24(30)23(29)26-18-7-9-19(10-8-18)32-20-11-14-31-16-20/h2-10,12-13,20-21H,11,14-16H2,1H3,(H,26,29)(H,27,30)/t20-,21-/m1/s1 |
| InChIKey | IBPYUSMTJVRHOF-NHCUHLMSSA-N |
| XLogP | 2.63 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|