C16H16N4O3 — CID 71869717
ethyl 4-[(2-indazol-1-ylacetyl)amino]-1H-pyrrole-2-carboxylate (PubChem CID 71869717) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is ethyl 4-[(2-indazol-1-ylacetyl)amino]-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 4-[(2-indazol-1-ylacetyl)amino]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 71869717 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | ethyl 4-[(2-indazol-1-ylacetyl)amino]-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1cc(NC(=O)Cn2ncc3ccccc32)c[nH]1 |
| InChI | InChI=1S/C16H16N4O3/c1-2-23-16(22)13-7-12(9-17-13)19-15(21)10-20-14-6-4-3-5-11(14)8-18-20/h3-9,17H,2,10H2,1H3,(H,19,21) |
| InChIKey | QEPWRZQEACAVJT-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |