C12H11ClN6O3 — CID 71869727
2-chloro-N-[(1-cyclopropyltetrazol-5-yl)methyl]-5-nitrobenzamide (PubChem CID 71869727) has the molecular formula C12H11ClN6O3 and a molecular weight of 322.71 g/mol. Its IUPAC name is 2-chloro-N-[(1-cyclopropyltetrazol-5-yl)methyl]-5-nitrobenzamide.
| Compound Name | 2-chloro-N-[(1-cyclopropyltetrazol-5-yl)methyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 71869727 |
| Molecular Formula | C12H11ClN6O3 |
| Molecular Weight | 322.71 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 2-chloro-N-[(1-cyclopropyltetrazol-5-yl)methyl]-5-nitrobenzamide |
| SMILES | O=C(NCc1nnnn1C1CC1)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C12H11ClN6O3/c13-10-4-3-8(19(21)22)5-9(10)12(20)14-6-11-15-16-17-18(11)7-1-2-7/h3-5,7H,1-2,6H2,(H,14,20) |
| InChIKey | ACOOXFYEZXLFBG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.71 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|