C21H19N3O4 — CID 71870866
2-[3-[3-[3-methyl-4-(1,2,4-triazol-1-yl)phenyl]prop-2-enoyl]phenoxy]propanoic acid (PubChem CID 71870866) has the molecular formula C21H19N3O4 and a molecular weight of 377.40 g/mol. Its IUPAC name is 2-[3-[3-[3-methyl-4-(1,2,4-triazol-1-yl)phenyl]prop-2-enoyl]phenoxy]propanoic acid.
| Compound Name | 2-[3-[3-[3-methyl-4-(1,2,4-triazol-1-yl)phenyl]prop-2-enoyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 71870866 |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 2-[3-[3-[3-methyl-4-(1,2,4-triazol-1-yl)phenyl]prop-2-enoyl]phenoxy]propanoic acid |
| SMILES | Cc1cc(C=CC(=O)c2cccc(OC(C)C(=O)O)c2)ccc1-n1cncn1 |
| InChI | InChI=1S/C21H19N3O4/c1-14-10-16(6-8-19(14)24-13-22-12-23-24)7-9-20(25)17-4-3-5-18(11-17)28-15(2)21(26)27/h3-13,15H,1-2H3,(H,26,27) |
| InChIKey | OOXKTDDTIFENPM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|