C17H11FN4O3 — CID 46518048
(E)-3-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-1-(3-nitrophenyl)prop-2-en-1-one (PubChem CID 46518048) has the molecular formula C17H11FN4O3 and a molecular weight of 338.30 g/mol. Its IUPAC name is (E)-3-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-1-(3-nitrophenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-1-(3-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 46518048 |
| Molecular Formula | C17H11FN4O3 |
| Molecular Weight | 338.30 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | (E)-3-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-1-(3-nitrophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(-n2cncn2)c(F)c1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H11FN4O3/c18-15-8-12(4-6-16(15)21-11-19-10-20-21)5-7-17(23)13-2-1-3-14(9-13)22(24)25/h1-11H/b7-5+ |
| InChIKey | NVFPIIQYSSHVGP-FNORWQNLSA-N |
| XLogP | 3.21 |
| TPSA | 90.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|