C16H12FN5O5S — CID 47892621
N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-3-methylsulfonyl-5-nitrobenzamide (PubChem CID 47892621) has the molecular formula C16H12FN5O5S and a molecular weight of 405.37 g/mol. Its IUPAC name is N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-3-methylsulfonyl-5-nitrobenzamide.
| Compound Name | N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-3-methylsulfonyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 47892621 |
| Molecular Formula | C16H12FN5O5S |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-3-methylsulfonyl-5-nitrobenzamide |
| SMILES | CS(=O)(=O)c1cc(C(=O)Nc2ccc(-n3cncn3)c(F)c2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H12FN5O5S/c1-28(26,27)13-5-10(4-12(7-13)22(24)25)16(23)20-11-2-3-15(14(17)6-11)21-9-18-8-19-21/h2-9H,1H3,(H,20,23) |
| InChIKey | SUASVFJRPKWSGS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 137.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|