C16H13FN4O2 — CID 47049179
N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-3-methoxybenzamide (PubChem CID 47049179) has the molecular formula C16H13FN4O2 and a molecular weight of 312.30 g/mol. Its IUPAC name is N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-3-methoxybenzamide.
| Compound Name | N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 47049179 |
| Molecular Formula | C16H13FN4O2 |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc(-n3cncn3)c(F)c2)c1 |
| InChI | InChI=1S/C16H13FN4O2/c1-23-13-4-2-3-11(7-13)16(22)20-12-5-6-15(14(17)8-12)21-10-18-9-19-21/h2-10H,1H3,(H,20,22) |
| InChIKey | RKUXCWVPAXFGMR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |