C19H19FN4O3 — CID 52660649
3,4-diethoxy-N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]benzamide (PubChem CID 52660649) has the molecular formula C19H19FN4O3 and a molecular weight of 370.38 g/mol. Its IUPAC name is 3,4-diethoxy-N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]benzamide.
| Compound Name | 3,4-diethoxy-N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 52660649 |
| Molecular Formula | C19H19FN4O3 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 3,4-diethoxy-N-[3-fluoro-4-(1,2,4-triazol-1-yl)phenyl]benzamide |
| SMILES | CCOc1ccc(C(=O)Nc2ccc(-n3cncn3)c(F)c2)cc1OCC |
| InChI | InChI=1S/C19H19FN4O3/c1-3-26-17-8-5-13(9-18(17)27-4-2)19(25)23-14-6-7-16(15(20)10-14)24-12-21-11-22-24/h5-12H,3-4H2,1-2H3,(H,23,25) |
| InChIKey | BNTHODFJHTVLJI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |