C17H23N5O3 — CID 71872660
N-(furan-2-ylmethyl)-2-[2-[[methyl(pyridazin-3-yl)amino]methyl]morpholin-4-yl]acetamide (PubChem CID 71872660) has the molecular formula C17H23N5O3 and a molecular weight of 345.40 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[2-[[methyl(pyridazin-3-yl)amino]methyl]morpholin-4-yl]acetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-[2-[[methyl(pyridazin-3-yl)amino]methyl]morpholin-4-yl]acetamide |
|---|---|
| PubChem CID | 71872660 |
| Molecular Formula | C17H23N5O3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[2-[[methyl(pyridazin-3-yl)amino]methyl]morpholin-4-yl]acetamide |
| SMILES | CN(CC1CN(CC(=O)NCc2ccco2)CCO1)c1cccnn1 |
| InChI | InChI=1S/C17H23N5O3/c1-21(16-5-2-6-19-20-16)11-15-12-22(7-9-25-15)13-17(23)18-10-14-4-3-8-24-14/h2-6,8,15H,7,9-13H2,1H3,(H,18,23) |
| InChIKey | USDNJBFOFJQXHP-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 83.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |