C22H28N2O — CID 718736
1-(4-benzhydrylpiperazin-1-yl)-2,2-dimethylpropan-1-one (PubChem CID 718736) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is 1-(4-benzhydrylpiperazin-1-yl)-2,2-dimethylpropan-1-one.
| Compound Name | 1-(4-benzhydrylpiperazin-1-yl)-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 718736 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 1-(4-benzhydrylpiperazin-1-yl)-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H28N2O/c1-22(2,3)21(25)24-16-14-23(15-17-24)20(18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-13,20H,14-17H2,1-3H3 |
| InChIKey | KWPBNLGNSFIDPC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |