C14H22N6O — CID 71873802
1-[(1-methylpyrazol-4-yl)methyl]-3-(5-pentan-2-yl-1H-pyrazol-3-yl)urea (PubChem CID 71873802) has the molecular formula C14H22N6O and a molecular weight of 290.37 g/mol. Its IUPAC name is 1-[(1-methylpyrazol-4-yl)methyl]-3-(5-pentan-2-yl-1H-pyrazol-3-yl)urea.
| Compound Name | 1-[(1-methylpyrazol-4-yl)methyl]-3-(5-pentan-2-yl-1H-pyrazol-3-yl)urea |
|---|---|
| PubChem CID | 71873802 |
| Molecular Formula | C14H22N6O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 1-[(1-methylpyrazol-4-yl)methyl]-3-(5-pentan-2-yl-1H-pyrazol-3-yl)urea |
| SMILES | CCCC(C)c1cc(NC(=O)NCc2cnn(C)c2)n[nH]1 |
| InChI | InChI=1S/C14H22N6O/c1-4-5-10(2)12-6-13(19-18-12)17-14(21)15-7-11-8-16-20(3)9-11/h6,8-10H,4-5,7H2,1-3H3,(H3,15,17,18,19,21) |
| InChIKey | VAVXMVBIIWXBCU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |