C14H17N3O2S — CID 71875047
N-(4-cyanophenyl)-2,3-dimethyl-1-oxo-1,4-thiazinane-4-carboxamide (PubChem CID 71875047) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is N-(4-cyanophenyl)-2,3-dimethyl-1-oxo-1,4-thiazinane-4-carboxamide.
| Compound Name | N-(4-cyanophenyl)-2,3-dimethyl-1-oxo-1,4-thiazinane-4-carboxamide |
|---|---|
| PubChem CID | 71875047 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | N-(4-cyanophenyl)-2,3-dimethyl-1-oxo-1,4-thiazinane-4-carboxamide |
| SMILES | CC1C(C)S(=O)CCN1C(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C14H17N3O2S/c1-10-11(2)20(19)8-7-17(10)14(18)16-13-5-3-12(9-15)4-6-13/h3-6,10-11H,7-8H2,1-2H3,(H,16,18) |
| InChIKey | GHLUNECJYALVBW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |