C22H22FNO5 — CID 7187621
(3-fluoro-4-methoxyphenyl)methyl 2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 7187621) has the molecular formula C22H22FNO5 and a molecular weight of 399.42 g/mol. Its IUPAC name is (3-fluoro-4-methoxyphenyl)methyl 2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (3-fluoro-4-methoxyphenyl)methyl 2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 7187621 |
| Molecular Formula | C22H22FNO5 |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | (3-fluoro-4-methoxyphenyl)methyl 2-(3-methylbutyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | COc1ccc(COC(=O)c2ccc3c(c2)C(=O)N(CCC(C)C)C3=O)cc1F |
| InChI | InChI=1S/C22H22FNO5/c1-13(2)8-9-24-20(25)16-6-5-15(11-17(16)21(24)26)22(27)29-12-14-4-7-19(28-3)18(23)10-14/h4-7,10-11,13H,8-9,12H2,1-3H3 |
| InChIKey | OEAZXDZRRXMIIW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|