C17H24N4O4 — CID 71878522
1-[3-(2,5-dioxopyrrolidin-1-yl)propyl]-3-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]urea (PubChem CID 71878522) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is 1-[3-(2,5-dioxopyrrolidin-1-yl)propyl]-3-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]urea.
| Compound Name | 1-[3-(2,5-dioxopyrrolidin-1-yl)propyl]-3-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 71878522 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 1-[3-(2,5-dioxopyrrolidin-1-yl)propyl]-3-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]urea |
| SMILES | COc1c(C)cnc(CNC(=O)NCCCN2C(=O)CCC2=O)c1C |
| InChI | InChI=1S/C17H24N4O4/c1-11-9-19-13(12(2)16(11)25-3)10-20-17(24)18-7-4-8-21-14(22)5-6-15(21)23/h9H,4-8,10H2,1-3H3,(H2,18,20,24) |
| InChIKey | ZRZARNZIOMIATI-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|