C16H20FN5O2 — CID 71879025
2-[(3-fluorophenyl)carbamoylamino]-4-methyl-N-(1H-pyrazol-5-yl)pentanamide (PubChem CID 71879025) has the molecular formula C16H20FN5O2 and a molecular weight of 333.37 g/mol. Its IUPAC name is 2-[(3-fluorophenyl)carbamoylamino]-4-methyl-N-(1H-pyrazol-5-yl)pentanamide.
| Compound Name | 2-[(3-fluorophenyl)carbamoylamino]-4-methyl-N-(1H-pyrazol-5-yl)pentanamide |
|---|---|
| PubChem CID | 71879025 |
| Molecular Formula | C16H20FN5O2 |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 2-[(3-fluorophenyl)carbamoylamino]-4-methyl-N-(1H-pyrazol-5-yl)pentanamide |
| SMILES | CC(C)CC(NC(=O)Nc1cccc(F)c1)C(=O)Nc1ccn[nH]1 |
| InChI | InChI=1S/C16H20FN5O2/c1-10(2)8-13(15(23)21-14-6-7-18-22-14)20-16(24)19-12-5-3-4-11(17)9-12/h3-7,9-10,13H,8H2,1-2H3,(H2,19,20,24)(H2,18,21,22,23) |
| InChIKey | CPTZBFNTQMRALT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 98.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |