C20H31NO3 — CID 7187928
(1R,4S)-4,7,7-trimethyl-1-[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl]-2-oxabicyclo[2.2.1]heptan-3-one (PubChem CID 7187928) has the molecular formula C20H31NO3 and a molecular weight of 333.47 g/mol. Its IUPAC name is (1R,4S)-4,7,7-trimethyl-1-[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl]-2-oxabicyclo[2.2.1]heptan-3-one.
| Compound Name | (1R,4S)-4,7,7-trimethyl-1-[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl]-2-oxabicyclo[2.2.1]heptan-3-one |
|---|---|
| PubChem CID | 7187928 |
| Molecular Formula | C20H31NO3 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | (1R,4S)-4,7,7-trimethyl-1-[(1R,5S)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane-6-carbonyl]-2-oxabicyclo[2.2.1]heptan-3-one |
| SMILES | CC1(C)C[C@H]2C[C@](C)(CN2C(=O)[C@]23CC[C@](C)(C(=O)O2)C3(C)C)C1 |
| InChI | InChI=1S/C20H31NO3/c1-16(2)9-13-10-18(5,11-16)12-21(13)14(22)20-8-7-19(6,15(23)24-20)17(20,3)4/h13H,7-12H2,1-6H3/t13-,18-,19+,20-/m0/s1 |
| InChIKey | KUFRUMHEWLMNLW-JZOCTASASA-N |
| XLogP | 3.54 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |