C22H18ClN3O3S — CID 71881361
2-(2-chlorophenyl)-N-[4-(2,6-dioxopiperidin-1-yl)phenyl]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 71881361) has the molecular formula C22H18ClN3O3S and a molecular weight of 439.92 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[4-(2,6-dioxopiperidin-1-yl)phenyl]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(2-chlorophenyl)-N-[4-(2,6-dioxopiperidin-1-yl)phenyl]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 71881361 |
| Molecular Formula | C22H18ClN3O3S |
| Molecular Weight | 439.92 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[4-(2,6-dioxopiperidin-1-yl)phenyl]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2ccccc2Cl)sc1C(=O)Nc1ccc(N2C(=O)CCCC2=O)cc1 |
| InChI | InChI=1S/C22H18ClN3O3S/c1-13-20(30-22(24-13)16-5-2-3-6-17(16)23)21(29)25-14-9-11-15(12-10-14)26-18(27)7-4-8-19(26)28/h2-3,5-6,9-12H,4,7-8H2,1H3,(H,25,29) |
| InChIKey | OVDSAKHZXWZWAF-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.92 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|