C18H22F4N2O3 — CID 71883254
[2-oxo-2-[[2-(trifluoromethyl)cyclohexyl]amino]ethyl] 4-(dimethylamino)-3-fluorobenzoate (PubChem CID 71883254) has the molecular formula C18H22F4N2O3 and a molecular weight of 390.38 g/mol. Its IUPAC name is [2-oxo-2-[[2-(trifluoromethyl)cyclohexyl]amino]ethyl] 4-(dimethylamino)-3-fluorobenzoate.
| Compound Name | [2-oxo-2-[[2-(trifluoromethyl)cyclohexyl]amino]ethyl] 4-(dimethylamino)-3-fluorobenzoate |
|---|---|
| PubChem CID | 71883254 |
| Molecular Formula | C18H22F4N2O3 |
| Molecular Weight | 390.38 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | [2-oxo-2-[[2-(trifluoromethyl)cyclohexyl]amino]ethyl] 4-(dimethylamino)-3-fluorobenzoate |
| SMILES | CN(C)c1ccc(C(=O)OCC(=O)NC2CCCCC2C(F)(F)F)cc1F |
| InChI | InChI=1S/C18H22F4N2O3/c1-24(2)15-8-7-11(9-13(15)19)17(26)27-10-16(25)23-14-6-4-3-5-12(14)18(20,21)22/h7-9,12,14H,3-6,10H2,1-2H3,(H,23,25) |
| InChIKey | XNSCDXUBTLPZGP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |