C20H23N3O2S — CID 71884647
N-[[3-(cyclohexanecarbonylamino)phenyl]methyl]-2-sulfanylidene-1H-pyridine-3-carboxamide (PubChem CID 71884647) has the molecular formula C20H23N3O2S and a molecular weight of 369.49 g/mol. Its IUPAC name is N-[[3-(cyclohexanecarbonylamino)phenyl]methyl]-2-sulfanylidene-1H-pyridine-3-carboxamide.
| Compound Name | N-[[3-(cyclohexanecarbonylamino)phenyl]methyl]-2-sulfanylidene-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 71884647 |
| Molecular Formula | C20H23N3O2S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | N-[[3-(cyclohexanecarbonylamino)phenyl]methyl]-2-sulfanylidene-1H-pyridine-3-carboxamide |
| SMILES | O=C(NCc1cccc(NC(=O)C2CCCCC2)c1)c1ccc[nH]c1=S |
| InChI | InChI=1S/C20H23N3O2S/c24-18(15-7-2-1-3-8-15)23-16-9-4-6-14(12-16)13-22-19(25)17-10-5-11-21-20(17)26/h4-6,9-12,15H,1-3,7-8,13H2,(H,21,26)(H,22,25)(H,23,24) |
| InChIKey | GRSOPLBBXFAZMM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|