C19H21N3O3S — CID 71884839
N-[1-(2-methoxyethyl)indazol-6-yl]-2,3-dihydro-1H-indene-5-sulfonamide (PubChem CID 71884839) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is N-[1-(2-methoxyethyl)indazol-6-yl]-2,3-dihydro-1H-indene-5-sulfonamide.
| Compound Name | N-[1-(2-methoxyethyl)indazol-6-yl]-2,3-dihydro-1H-indene-5-sulfonamide |
|---|---|
| PubChem CID | 71884839 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N-[1-(2-methoxyethyl)indazol-6-yl]-2,3-dihydro-1H-indene-5-sulfonamide |
| SMILES | COCCn1ncc2ccc(NS(=O)(=O)c3ccc4c(c3)CCC4)cc21 |
| InChI | InChI=1S/C19H21N3O3S/c1-25-10-9-22-19-12-17(7-5-16(19)13-20-22)21-26(23,24)18-8-6-14-3-2-4-15(14)11-18/h5-8,11-13,21H,2-4,9-10H2,1H3 |
| InChIKey | QXECVHORVPIEBB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |