C16H23N3OS — CID 71887446
N-(2,3-dihydro-1H-inden-5-yl)-4-(2-hydroxyethyl)piperazine-1-carbothioamide (PubChem CID 71887446) has the molecular formula C16H23N3OS and a molecular weight of 305.45 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-5-yl)-4-(2-hydroxyethyl)piperazine-1-carbothioamide.
| Compound Name | N-(2,3-dihydro-1H-inden-5-yl)-4-(2-hydroxyethyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 71887446 |
| Molecular Formula | C16H23N3OS |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-5-yl)-4-(2-hydroxyethyl)piperazine-1-carbothioamide |
| SMILES | OCCN1CCN(C(=S)Nc2ccc3c(c2)CCC3)CC1 |
| InChI | InChI=1S/C16H23N3OS/c20-11-10-18-6-8-19(9-7-18)16(21)17-15-5-4-13-2-1-3-14(13)12-15/h4-5,12,20H,1-3,6-11H2,(H,17,21) |
| InChIKey | SPUMOUNVPSDLQX-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|