C18H20F3NO5 — CID 71887718
[2-oxo-2-[3-(trifluoromethyl)piperidin-1-yl]ethyl] 3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate (PubChem CID 71887718) has the molecular formula C18H20F3NO5 and a molecular weight of 387.35 g/mol. Its IUPAC name is [2-oxo-2-[3-(trifluoromethyl)piperidin-1-yl]ethyl] 3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-[3-(trifluoromethyl)piperidin-1-yl]ethyl] 3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 71887718 |
| Molecular Formula | C18H20F3NO5 |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | [2-oxo-2-[3-(trifluoromethyl)piperidin-1-yl]ethyl] 3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(C=CC(=O)OCC(=O)N2CCCC(C(F)(F)F)C2)cc1O |
| InChI | InChI=1S/C18H20F3NO5/c1-26-15-6-4-12(9-14(15)23)5-7-17(25)27-11-16(24)22-8-2-3-13(10-22)18(19,20)21/h4-7,9,13,23H,2-3,8,10-11H2,1H3 |
| InChIKey | SJLZGCSFSQCRQD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|