C17H16Cl2N2O3S — CID 71888055
[2-oxo-2-(2-thiophen-3-ylpyrrolidin-1-yl)ethyl] 2-amino-3,5-dichlorobenzoate (PubChem CID 71888055) has the molecular formula C17H16Cl2N2O3S and a molecular weight of 399.30 g/mol. Its IUPAC name is [2-oxo-2-(2-thiophen-3-ylpyrrolidin-1-yl)ethyl] 2-amino-3,5-dichlorobenzoate.
| Compound Name | [2-oxo-2-(2-thiophen-3-ylpyrrolidin-1-yl)ethyl] 2-amino-3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 71888055 |
| Molecular Formula | C17H16Cl2N2O3S |
| Molecular Weight | 399.30 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | [2-oxo-2-(2-thiophen-3-ylpyrrolidin-1-yl)ethyl] 2-amino-3,5-dichlorobenzoate |
| SMILES | Nc1c(Cl)cc(Cl)cc1C(=O)OCC(=O)N1CCCC1c1ccsc1 |
| InChI | InChI=1S/C17H16Cl2N2O3S/c18-11-6-12(16(20)13(19)7-11)17(23)24-8-15(22)21-4-1-2-14(21)10-3-5-25-9-10/h3,5-7,9,14H,1-2,4,8,20H2 |
| InChIKey | TVCXLJONKPNTLC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.30 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|